|
Thông tin chi tiết sản phẩm:
Thanh toán:
|
| Tunnel size: | 6150 * 418 mm | Belt load: | 170kg |
|---|---|---|---|
| Belt speed: | 0.22 m/s | Image: | color |
| Computer system: | Windows XP or 7 | Software: | Multi-language |
| Remote: | remote workstation | Display: | 17'' monitor |
| Technical training: | free | body frame: | stainless steel |
| Điểm nổi bật: | security screening equipment,airport baggage scanner |
||
General Specification of x-ray inspeciton amchine:
* Tunnel Size: 6150(W)*418(H)mm
* Conveyor Speed: 0.22m/s
* Conveyor Max Load: 170kg
* Dose per Inspection: <2.9 μGy/h
* Resolution: <0.101mm Metal Wire
* Spatial resolution: Level: dia1.0mm, Vertical: dia1.3mm
* Penetrate resolution: Dia 0.511mm
* Penetration: 32mm Steel
* Film Safety: Guarantee ISO1600 Film
* X-ray Leakage: <0.05 μGy/h (at a distance of 5cm From external housing)
X-ray Generator of x-ray baggage detector
* Generate direct: Upward
* Generate angle: 80 degree
* Anode Voltage: 140Kv
* Anode power: 0.3mA
* Cooling / Duty Cycle: Oil Cooling /100%
Image System of x-ray baggage detector
* X-ray Sensor: L-Shaped Photodiode Array (multi-energetic), 12bit Deep
* Monitor: High Resolution Color, LCD Accord, 19 inch, operation desk(optional)
* Image Processing: Edge enhancement, image strengthening, image lightening,, reducing darkening, image returning, image retrieval.
* Image Grey Level: 4096
* Image Max Resolution: 1024 * 1280pixel
* Image Processing: 24bit for processing real time
* Image storage: Storage 60000 pictures in real time
* Zones & Zoom: 1-32 Image regions,Whole screen continuous observation
* Multi-energetic distinguish objects: organic objects in orange, inorganic objects in blue, mixture in green
* Assist to detect drug and explosive powder
* TIP & operator training program
* Remote workstation
Installation Data of x-ray baggage detector
Operation temperature/Humidity: 0°C-45°C/20%-95%(non-condensing)
Storage Temperature/Humidity: -20°C-60°C/20%-95%(non-condensing)
Operation Power: 187~240VAC, 50/60Hz
Power Consumption: 1KW(working)
Noise: <55db
Người liên hệ: Mr. Ben CHEN
Tel: 86-13480182964
Fax: 86-755-89671033
